C11H12I2O — CID 14092920
(2,2-diiodo-1-propan-2-yloxyethenyl)benzene (PubChem CID 14092920) has the molecular formula C11H12I2O and a molecular weight of 414.02 g/mol. Its IUPAC name is (2,2-diiodo-1-propan-2-yloxyethenyl)benzene.
| Compound Name | (2,2-diiodo-1-propan-2-yloxyethenyl)benzene |
|---|---|
| PubChem CID | 14092920 |
| Molecular Formula | C11H12I2O |
| Molecular Weight | 414.02 g/mol |
| Exact Mass | 413.90 |
| IUPAC Name | (2,2-diiodo-1-propan-2-yloxyethenyl)benzene |
| SMILES | CC(C)OC(=C(I)I)c1ccccc1 |
| InChI | InChI=1S/C11H12I2O/c1-8(2)14-10(11(12)13)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | RJLASQAQMFNMBN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|