C8H6Cl3NO — CID 170909172
(NZ)-N-(2,2,2-trichloro-1-phenylethylidene)hydroxylamine (PubChem CID 170909172) has the molecular formula C8H6Cl3NO and a molecular weight of 238.50 g/mol. Its IUPAC name is (NZ)-N-(2,2,2-trichloro-1-phenylethylidene)hydroxylamine.
| Compound Name | (NZ)-N-(2,2,2-trichloro-1-phenylethylidene)hydroxylamine |
|---|---|
| PubChem CID | 170909172 |
| Molecular Formula | C8H6Cl3NO |
| Molecular Weight | 238.50 g/mol |
| Exact Mass | 236.95 |
| IUPAC Name | (NZ)-N-(2,2,2-trichloro-1-phenylethylidene)hydroxylamine |
| SMILES | O/N=C(/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H6Cl3NO/c9-8(10,11)7(12-13)6-4-2-1-3-5-6/h1-5,13H/b12-7- |
| InChIKey | YVYJWHDHTSPGOT-GHXNOFRVSA-N |
| XLogP | 3.24 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|