C15H23NO — CID 173302298
N-(2,2,4,4-tetramethyl-1-phenylpentylidene)hydroxylamine (PubChem CID 173302298) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-(2,2,4,4-tetramethyl-1-phenylpentylidene)hydroxylamine.
| Compound Name | N-(2,2,4,4-tetramethyl-1-phenylpentylidene)hydroxylamine |
|---|---|
| PubChem CID | 173302298 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-(2,2,4,4-tetramethyl-1-phenylpentylidene)hydroxylamine |
| SMILES | CC(C)(C)CC(C)(C)C(=NO)c1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-14(2,3)11-15(4,5)13(16-17)12-9-7-6-8-10-12/h6-10,17H,11H2,1-5H3 |
| InChIKey | PTHJVWKEKMSNMN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|