C15H23N — CID 15739864
N-tert-butyl-2,2-dimethyl-1-phenylpropan-1-imine (PubChem CID 15739864) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethyl-1-phenylpropan-1-imine.
| Compound Name | N-tert-butyl-2,2-dimethyl-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 15739864 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-tert-butyl-2,2-dimethyl-1-phenylpropan-1-imine |
| SMILES | CC(C)(C)/N=C(\c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H23N/c1-14(2,3)13(16-15(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3/b16-13+ |
| InChIKey | CDXQKGHLGUYYTQ-DTQAZKPQSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|