C25H27N — CID 139191179
N-[(1R)-1,2-diphenylethyl]-2,2-dimethyl-1-phenylpropan-1-imine (PubChem CID 139191179) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[(1R)-1,2-diphenylethyl]-2,2-dimethyl-1-phenylpropan-1-imine.
| Compound Name | N-[(1R)-1,2-diphenylethyl]-2,2-dimethyl-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 139191179 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[(1R)-1,2-diphenylethyl]-2,2-dimethyl-1-phenylpropan-1-imine |
| SMILES | CC(C)(C)/C(=N/[C@H](Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N/c1-25(2,3)24(22-17-11-6-12-18-22)26-23(21-15-9-5-10-16-21)19-20-13-7-4-8-14-20/h4-18,23H,19H2,1-3H3/b26-24+/t23-/m1/s1 |
| InChIKey | RWDGNTPZFYOMRA-LIZHXUNESA-N |
| XLogP | 6.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|