C25H26FN — CID 71819222
N-(1,2-diphenylethyl)-1-(3-fluorophenyl)-2,2-dimethylpropan-1-imine (PubChem CID 71819222) has the molecular formula C25H26FN and a molecular weight of 359.49 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-1-(3-fluorophenyl)-2,2-dimethylpropan-1-imine.
| Compound Name | N-(1,2-diphenylethyl)-1-(3-fluorophenyl)-2,2-dimethylpropan-1-imine |
|---|---|
| PubChem CID | 71819222 |
| Molecular Formula | C25H26FN |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-(1,2-diphenylethyl)-1-(3-fluorophenyl)-2,2-dimethylpropan-1-imine |
| SMILES | CC(C)(C)/C(=N/C(Cc1ccccc1)c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C25H26FN/c1-25(2,3)24(21-15-10-16-22(26)18-21)27-23(20-13-8-5-9-14-20)17-19-11-6-4-7-12-19/h4-16,18,23H,17H2,1-3H3/b27-24+ |
| InChIKey | MYOGTWSYSDFYNN-SOYKGTTHSA-N |
| XLogP | 6.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|