C12H17F — CID 168850046
1-[(2R)-3,3-dimethylbutan-2-yl]-3-fluorobenzene (PubChem CID 168850046) has the molecular formula C12H17F and a molecular weight of 180.27 g/mol. Its IUPAC name is 1-[(2R)-3,3-dimethylbutan-2-yl]-3-fluorobenzene.
| Compound Name | 1-[(2R)-3,3-dimethylbutan-2-yl]-3-fluorobenzene |
|---|---|
| PubChem CID | 168850046 |
| Molecular Formula | C12H17F |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-[(2R)-3,3-dimethylbutan-2-yl]-3-fluorobenzene |
| SMILES | C[C@@H](c1cccc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C12H17F/c1-9(12(2,3)4)10-6-5-7-11(13)8-10/h5-9H,1-4H3/t9-/m0/s1 |
| InChIKey | VXYDJFOCDDBCRX-VIFPVBQESA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |