C24H42 — CID 11489581
1,3,5-tris[(2S)-3,3-dimethylbutan-2-yl]benzene (PubChem CID 11489581) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1,3,5-tris[(2S)-3,3-dimethylbutan-2-yl]benzene.
| Compound Name | 1,3,5-tris[(2S)-3,3-dimethylbutan-2-yl]benzene |
|---|---|
| PubChem CID | 11489581 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 1,3,5-tris[(2S)-3,3-dimethylbutan-2-yl]benzene |
| SMILES | C[C@H](c1cc([C@@H](C)C(C)(C)C)cc([C@@H](C)C(C)(C)C)c1)C(C)(C)C |
| InChI | InChI=1S/C24H42/c1-16(22(4,5)6)19-13-20(17(2)23(7,8)9)15-21(14-19)18(3)24(10,11)12/h13-18H,1-12H3/t16-,17-,18-/m1/s1 |
| InChIKey | CZFDZPXNIWAYKG-KZNAEPCWSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |