C12H20N2 — CID 163881533
5-[(2R)-3,3-dimethylbutan-2-yl]benzene-1,3-diamine (PubChem CID 163881533) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 5-[(2R)-3,3-dimethylbutan-2-yl]benzene-1,3-diamine.
| Compound Name | 5-[(2R)-3,3-dimethylbutan-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 163881533 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5-[(2R)-3,3-dimethylbutan-2-yl]benzene-1,3-diamine |
| SMILES | C[C@@H](c1cc(N)cc(N)c1)C(C)(C)C |
| InChI | InChI=1S/C12H20N2/c1-8(12(2,3)4)9-5-10(13)7-11(14)6-9/h5-8H,13-14H2,1-4H3/t8-/m0/s1 |
| InChIKey | PTPZYKWVUSYOOT-QMMMGPOBSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|