C13H17FN2 — CID 97334665
2-[[(1S)-1-(3-fluorophenyl)-2,2-dimethylpropyl]amino]acetonitrile (PubChem CID 97334665) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-[[(1S)-1-(3-fluorophenyl)-2,2-dimethylpropyl]amino]acetonitrile.
| Compound Name | 2-[[(1S)-1-(3-fluorophenyl)-2,2-dimethylpropyl]amino]acetonitrile |
|---|---|
| PubChem CID | 97334665 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-[[(1S)-1-(3-fluorophenyl)-2,2-dimethylpropyl]amino]acetonitrile |
| SMILES | CC(C)(C)[C@H](NCC#N)c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2/c1-13(2,3)12(16-8-7-15)10-5-4-6-11(14)9-10/h4-6,9,12,16H,8H2,1-3H3/t12-/m1/s1 |
| InChIKey | QZLGCILSWQPETP-GFCCVEGCSA-N |
| XLogP | 3.03 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|