C12H15FN2 — CID 81365817
3-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2-methylpropanenitrile (PubChem CID 81365817) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 3-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2-methylpropanenitrile.
| Compound Name | 3-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 81365817 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CN[C@@H](C)c1cccc(F)c1 |
| InChI | InChI=1S/C12H15FN2/c1-9(7-14)8-15-10(2)11-4-3-5-12(13)6-11/h3-6,9-10,15H,8H2,1-2H3/t9?,10-/m0/s1 |
| InChIKey | JTLHIMNGISVRDN-AXDSSHIGSA-N |
| XLogP | 2.64 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |