C17H18FNO2 — CID 81351937
3-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-2-phenylpropanoic acid (PubChem CID 81351937) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 3-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-2-phenylpropanoic acid.
| Compound Name | 3-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 81351937 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-2-phenylpropanoic acid |
| SMILES | C[C@@H](NCC(C(=O)O)c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H18FNO2/c1-12(14-8-5-9-15(18)10-14)19-11-16(17(20)21)13-6-3-2-4-7-13/h2-10,12,16,19H,11H2,1H3,(H,20,21)/t12-,16?/m1/s1 |
| InChIKey | NLVQJAVRUXNXST-ZGTOLYCTSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |