C15H17NO3 — CID 81399651
3-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-phenylpropanoic acid (PubChem CID 81399651) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-phenylpropanoic acid.
| Compound Name | 3-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 81399651 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-phenylpropanoic acid |
| SMILES | C[C@@H](NCC(C(=O)O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C15H17NO3/c1-11(14-8-5-9-19-14)16-10-13(15(17)18)12-6-3-2-4-7-12/h2-9,11,13,16H,10H2,1H3,(H,17,18)/t11-,13?/m1/s1 |
| InChIKey | STTOUMQUZSVRMT-JTDNENJMSA-N |
| XLogP | 2.80 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |