C10H15NO4 — CID 104644855
3-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 104644855) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 3-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 104644855 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | C[C@H](NCC(C)(O)C(=O)O)c1ccco1 |
| InChI | InChI=1S/C10H15NO4/c1-7(8-4-3-5-15-8)11-6-10(2,14)9(12)13/h3-5,7,11,14H,6H2,1-2H3,(H,12,13)/t7-,10?/m0/s1 |
| InChIKey | SSTIHBHKZRRIBQ-BYDSUWOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |