C10H15NO3 — CID 82238331
2-[1-(furan-2-yl)ethylamino]-2-methylpropanoic acid (PubChem CID 82238331) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-[1-(furan-2-yl)ethylamino]-2-methylpropanoic acid.
| Compound Name | 2-[1-(furan-2-yl)ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82238331 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-[1-(furan-2-yl)ethylamino]-2-methylpropanoic acid |
| SMILES | CC(NC(C)(C)C(=O)O)c1ccco1 |
| InChI | InChI=1S/C10H15NO3/c1-7(8-5-4-6-14-8)11-10(2,3)9(12)13/h4-7,11H,1-3H3,(H,12,13) |
| InChIKey | FTDDCXWPPXQIQL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |