C9H13NO3 — CID 55292739
(3S)-3-amino-3-(furan-2-yl)-2,2-dimethylpropanoic acid (PubChem CID 55292739) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3S)-3-amino-3-(furan-2-yl)-2,2-dimethylpropanoic acid.
| Compound Name | (3S)-3-amino-3-(furan-2-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 55292739 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (3S)-3-amino-3-(furan-2-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(C(=O)O)[C@H](N)c1ccco1 |
| InChI | InChI=1S/C9H13NO3/c1-9(2,8(11)12)7(10)6-4-3-5-13-6/h3-5,7H,10H2,1-2H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | QSBCASGHGWOJEY-SSDOTTSWSA-N |
| XLogP | 1.39 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |