C11H17NO4 — CID 12071973
tert-butyl (2R,3R)-2-amino-3-(furan-2-yl)-3-hydroxypropanoate (PubChem CID 12071973) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-amino-3-(furan-2-yl)-3-hydroxypropanoate.
| Compound Name | tert-butyl (2R,3R)-2-amino-3-(furan-2-yl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 12071973 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | tert-butyl (2R,3R)-2-amino-3-(furan-2-yl)-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](N)[C@@H](O)c1ccco1 |
| InChI | InChI=1S/C11H17NO4/c1-11(2,3)16-10(14)8(12)9(13)7-5-4-6-15-7/h4-6,8-9,13H,12H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | FUZVCRTWMYFGQA-BDAKNGLRSA-N |
| XLogP | 0.98 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |