C13H18BrNO3 — CID 46900208
tert-butyl (2S,3R)-2-amino-3-(3-bromophenyl)-3-hydroxypropanoate (PubChem CID 46900208) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-amino-3-(3-bromophenyl)-3-hydroxypropanoate.
| Compound Name | tert-butyl (2S,3R)-2-amino-3-(3-bromophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 46900208 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | tert-butyl (2S,3R)-2-amino-3-(3-bromophenyl)-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)[C@H](O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO3/c1-13(2,3)18-12(17)10(15)11(16)8-5-4-6-9(14)7-8/h4-7,10-11,16H,15H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | PBJHDLAUVWECPT-WDEREUQCSA-N |
| XLogP | 2.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |