C12H17BrN2O3 — CID 125456888
tert-butyl (2S,3S)-2-amino-3-(2-bromo-3-pyridinyl)-3-hydroxypropanoate (PubChem CID 125456888) has the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-amino-3-(2-bromo-3-pyridinyl)-3-hydroxypropanoate.
| Compound Name | tert-butyl (2S,3S)-2-amino-3-(2-bromo-3-pyridinyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 125456888 |
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | tert-butyl (2S,3S)-2-amino-3-(2-bromo-3-pyridinyl)-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)[C@@H](O)c1cccnc1Br |
| InChI | InChI=1S/C12H17BrN2O3/c1-12(2,3)18-11(17)8(14)9(16)7-5-4-6-15-10(7)13/h4-6,8-9,16H,14H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | HBIWDDGWJOOTCX-IUCAKERBSA-N |
| XLogP | 1.55 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|