C14H13Cl2F7N2 — CID 134921542
(E)-(1-amino-2,2,3,3,4,4,4-heptafluorobutylidene)-[(Z)-1-chloro-2-phenylbut-1-enyl]azanium chloride (PubChem CID 134921542) has the molecular formula C14H13Cl2F7N2 and a molecular weight of 413.16 g/mol. Its IUPAC name is (E)-(1-amino-2,2,3,3,4,4,4-heptafluorobutylidene)-[(Z)-1-chloro-2-phenylbut-1-enyl]azanium chloride.
| Compound Name | (E)-(1-amino-2,2,3,3,4,4,4-heptafluorobutylidene)-[(Z)-1-chloro-2-phenylbut-1-enyl]azanium chloride |
|---|---|
| PubChem CID | 134921542 |
| Molecular Formula | C14H13Cl2F7N2 |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | (E)-(1-amino-2,2,3,3,4,4,4-heptafluorobutylidene)-[(Z)-1-chloro-2-phenylbut-1-enyl]azanium chloride |
| SMILES | CC/C(=C(Cl)\[NH+]=C(\N)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C14H12ClF7N2.ClH/c1-2-9(8-6-4-3-5-7-8)10(15)24-11(23)12(16,17)13(18,19)14(20,21)22;/h3-7H,2H2,1H3,(H2,23,24);1H/b10-9+; |
| InChIKey | RTTZKZOBIGKAIW-RRABGKBLSA-N |
| XLogP | 0.28 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|