C11H5ClF8 — CID 23235181
[(E)-1-chloro-1,3,3,4,4,5,5,5-octafluoropent-1-en-2-yl]benzene (PubChem CID 23235181) has the molecular formula C11H5ClF8 and a molecular weight of 324.60 g/mol. Its IUPAC name is [(E)-1-chloro-1,3,3,4,4,5,5,5-octafluoropent-1-en-2-yl]benzene.
| Compound Name | [(E)-1-chloro-1,3,3,4,4,5,5,5-octafluoropent-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 23235181 |
| Molecular Formula | C11H5ClF8 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | [(E)-1-chloro-1,3,3,4,4,5,5,5-octafluoropent-1-en-2-yl]benzene |
| SMILES | F/C(Cl)=C(/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5ClF8/c12-8(13)7(6-4-2-1-3-5-6)9(14,15)10(16,17)11(18,19)20/h1-5H/b8-7- |
| InChIKey | JHKSVESPNJDFNC-FPLPWBNLSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|