C13H19NO — CID 134987822
(E)-1-methoxy-N,N-dimethyl-2-phenylbut-1-en-1-amine (PubChem CID 134987822) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (E)-1-methoxy-N,N-dimethyl-2-phenylbut-1-en-1-amine.
| Compound Name | (E)-1-methoxy-N,N-dimethyl-2-phenylbut-1-en-1-amine |
|---|---|
| PubChem CID | 134987822 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (E)-1-methoxy-N,N-dimethyl-2-phenylbut-1-en-1-amine |
| SMILES | CC/C(=C(\OC)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-5-12(13(15-4)14(2)3)11-9-7-6-8-10-11/h6-10H,5H2,1-4H3/b13-12+ |
| InChIKey | XENSIPGLNHLKBH-OUKQBFOZSA-N |
| XLogP | 2.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|