About (Z)-2,3-diphenylbut-2-enedithial
(Z)-2,3-diphenylbut-2-enedithial (PubChem CID 101175637) has the molecular formula C16H12S2
and a molecular weight of 268.41 g/mol. Its IUPAC name is (Z)-2,3-diphenylbut-2-enedithial.
Molecular Properties
| Compound Name | (Z)-2,3-diphenylbut-2-enedithial |
| PubChem CID | 101175637 |
| Molecular Formula | C16H12S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (Z)-2,3-diphenylbut-2-enedithial |
| SMILES | S=C/C(=C(\C=S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12S2/c17-11-15(13-7-3-1-4-8-13)16(12-18)14-9-5-2-6-10-14/h1-12H/b16-15- |
| InChIKey | AYWSCMSRJUZAER-NXVVXOECSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-diphenylbut-2-enedithial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-diphenylbut-2-enedithial?
The IUPAC name of (Z)-2,3-diphenylbut-2-enedithial (CID 101175637) is (Z)-2,3-diphenylbut-2-enedithial.
What is the SMILES notation for (Z)-2,3-diphenylbut-2-enedithial?
The canonical SMILES for (Z)-2,3-diphenylbut-2-enedithial is S=C/C(=C(\C=S)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-2,3-diphenylbut-2-enedithial?
The InChIKey is AYWSCMSRJUZAER-NXVVXOECSA-N. The full InChI is InChI=1S/C16H12S2/c17-11-15(13-7-3-1-4-8-13)16(12-18)14-9-5-2-6-10-14/h1-12H/b16-15-.
What are the key properties of (Z)-2,3-diphenylbut-2-enedithial?
(Z)-2,3-diphenylbut-2-enedithial has a molecular weight of 268.41 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-diphenylbut-2-enedithial is sourced from PubChem (CID 101175637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).