C26H24 — CID 138972060
[(5E)-3,8-bis(ethenyl)-7-phenyldeca-1,3,5,7,9-pentaen-4-yl]benzene (PubChem CID 138972060) has the molecular formula C26H24 and a molecular weight of 336.48 g/mol. Its IUPAC name is [(5E)-3,8-bis(ethenyl)-7-phenyldeca-1,3,5,7,9-pentaen-4-yl]benzene.
| Compound Name | [(5E)-3,8-bis(ethenyl)-7-phenyldeca-1,3,5,7,9-pentaen-4-yl]benzene |
|---|---|
| PubChem CID | 138972060 |
| Molecular Formula | C26H24 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [(5E)-3,8-bis(ethenyl)-7-phenyldeca-1,3,5,7,9-pentaen-4-yl]benzene |
| SMILES | C=CC(C=C)=C(/C=C/C(=C(C=C)C=C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24/c1-5-21(6-2)25(23-15-11-9-12-16-23)19-20-26(22(7-3)8-4)24-17-13-10-14-18-24/h5-20H,1-4H2/b20-19+ |
| InChIKey | UFLJZDRNYZTAGQ-FMQUCBEESA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|