C16H15O3P — CID 175137744
1,2-diphenylbuta-1,3-dienylphosphonic acid (PubChem CID 175137744) has the molecular formula C16H15O3P and a molecular weight of 286.27 g/mol. Its IUPAC name is 1,2-diphenylbuta-1,3-dienylphosphonic acid.
| Compound Name | 1,2-diphenylbuta-1,3-dienylphosphonic acid |
|---|---|
| PubChem CID | 175137744 |
| Molecular Formula | C16H15O3P |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1,2-diphenylbuta-1,3-dienylphosphonic acid |
| SMILES | C=CC(=C(c1ccccc1)P(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C16H15O3P/c1-2-15(13-9-5-3-6-10-13)16(20(17,18)19)14-11-7-4-8-12-14/h2-12H,1H2,(H2,17,18,19) |
| InChIKey | JJDRUOSAOSHBTK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|