C19H32 — CID 143435257
ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]benzene (PubChem CID 143435257) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]benzene.
| Compound Name | ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]benzene |
|---|---|
| PubChem CID | 143435257 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]benzene |
| SMILES | C=C/C(C)=C(\C=C)c1ccccc1.CC.CC.CC |
| InChI | InChI=1S/C13H14.3C2H6/c1-4-11(3)13(5-2)12-9-7-6-8-10-12;3*1-2/h4-10H,1-2H2,3H3;3*1-2H3/b13-11+;;; |
| InChIKey | AGBPKHRWOXOERB-WNHODISBSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|