C11H12O — CID 155692254
2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]furan (PubChem CID 155692254) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]furan.
| Compound Name | 2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]furan |
|---|---|
| PubChem CID | 155692254 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]furan |
| SMILES | C=C/C(C)=C(\C=C)c1ccco1 |
| InChI | InChI=1S/C11H12O/c1-4-9(3)10(5-2)11-7-6-8-12-11/h4-8H,1-2H2,3H3/b10-9+ |
| InChIKey | VYNFQXXTTJMAHM-MDZDMXLPSA-N |
| XLogP | 3.43 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|