C15H21N — CID 156737667
4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane (PubChem CID 156737667) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane.
| Compound Name | 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane |
|---|---|
| PubChem CID | 156737667 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane |
| SMILES | C=C/C(C)=C(\C=C)c1ccncc1.CCC |
| InChI | InChI=1S/C12H13N.C3H8/c1-4-10(3)12(5-2)11-6-8-13-9-7-11;1-3-2/h4-9H,1-2H2,3H3;3H2,1-2H3/b12-10+; |
| InChIKey | AQDRWRNTRSIMFM-VHPXAQPISA-N |
| XLogP | 4.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|