About 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane
4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane (PubChem CID 156737667) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane.
Molecular Properties
| Compound Name | 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane |
| PubChem CID | 156737667 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane |
| SMILES | C=C/C(C)=C(\C=C)c1ccncc1.CCC |
| InChI | InChI=1S/C12H13N.C3H8/c1-4-10(3)12(5-2)11-6-8-13-9-7-11;1-3-2/h4-9H,1-2H2,3H3;3H2,1-2H3/b12-10+; |
| InChIKey | AQDRWRNTRSIMFM-VHPXAQPISA-N |
| XLogP | 4.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane?
The IUPAC name of 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane (CID 156737667) is 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane.
What is the SMILES notation for 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane?
The canonical SMILES for 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane is C=C/C(C)=C(\C=C)c1ccncc1.CCC.
What is the InChIKey of 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane?
The InChIKey is AQDRWRNTRSIMFM-VHPXAQPISA-N. The full InChI is InChI=1S/C12H13N.C3H8/c1-4-10(3)12(5-2)11-6-8-13-9-7-11;1-3-2/h4-9H,1-2H2,3H3;3H2,1-2H3/b12-10+;.
What are the key properties of 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane?
4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane has a molecular weight of 215.34 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyridine;propane is sourced from PubChem (CID 156737667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).