C13H15NO — CID 142878844
(2E,4Z)-2,3-dimethyl-4-pyridin-4-ylhexa-2,4-dienal (PubChem CID 142878844) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (2E,4Z)-2,3-dimethyl-4-pyridin-4-ylhexa-2,4-dienal.
| Compound Name | (2E,4Z)-2,3-dimethyl-4-pyridin-4-ylhexa-2,4-dienal |
|---|---|
| PubChem CID | 142878844 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2E,4Z)-2,3-dimethyl-4-pyridin-4-ylhexa-2,4-dienal |
| SMILES | C/C=C(C(\C)=C(/C)C=O)/c1ccncc1 |
| InChI | InChI=1S/C13H15NO/c1-4-13(11(3)10(2)9-15)12-5-7-14-8-6-12/h4-9H,1-3H3/b11-10+,13-4+ |
| InChIKey | HUXXBNVQCADRNP-ABDBBEBTSA-N |
| XLogP | 3.02 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|