C17H26N2 — CID 142603276
(3E,5Z)-2,3-dimethyl-4-propyl-5-pyridin-4-ylhepta-3,5-dien-1-amine (PubChem CID 142603276) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (3E,5Z)-2,3-dimethyl-4-propyl-5-pyridin-4-ylhepta-3,5-dien-1-amine.
| Compound Name | (3E,5Z)-2,3-dimethyl-4-propyl-5-pyridin-4-ylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142603276 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (3E,5Z)-2,3-dimethyl-4-propyl-5-pyridin-4-ylhepta-3,5-dien-1-amine |
| SMILES | C/C=C(C(\CCC)=C(/C)C(C)CN)/c1ccncc1 |
| InChI | InChI=1S/C17H26N2/c1-5-7-17(14(4)13(3)12-18)16(6-2)15-8-10-19-11-9-15/h6,8-11,13H,5,7,12,18H2,1-4H3/b16-6-,17-14+ |
| InChIKey | XKVQGEKZAZMJFR-ORTCBAPCSA-N |
| XLogP | 4.20 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|