C17H16 — CID 175534652
2-phenylpenta-2,4-dien-3-ylbenzene (PubChem CID 175534652) has the molecular formula C17H16 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-phenylpenta-2,4-dien-3-ylbenzene.
| Compound Name | 2-phenylpenta-2,4-dien-3-ylbenzene |
|---|---|
| PubChem CID | 175534652 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-phenylpenta-2,4-dien-3-ylbenzene |
| SMILES | C=CC(=C(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16/c1-3-17(16-12-8-5-9-13-16)14(2)15-10-6-4-7-11-15/h3-13H,1H2,2H3 |
| InChIKey | LKGFHVSBKHKJMY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|