About 2-methylbuta-1,3-diene;pyrazine
2-methylbuta-1,3-diene;pyrazine (PubChem CID 175573056) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;pyrazine.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-diene;pyrazine |
| PubChem CID | 175573056 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-methylbuta-1,3-diene;pyrazine |
| SMILES | C=CC(=C)C.c1cnccn1 |
| InChI | InChI=1S/C5H8.C4H4N2/c1-4-5(2)3;1-2-6-4-3-5-1/h4H,1-2H2,3H3;1-4H |
| InChIKey | WVVPKCPLXADLQC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-diene;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-diene;pyrazine?
The IUPAC name of 2-methylbuta-1,3-diene;pyrazine (CID 175573056) is 2-methylbuta-1,3-diene;pyrazine.
What is the SMILES notation for 2-methylbuta-1,3-diene;pyrazine?
The canonical SMILES for 2-methylbuta-1,3-diene;pyrazine is C=CC(=C)C.c1cnccn1.
What is the InChIKey of 2-methylbuta-1,3-diene;pyrazine?
The InChIKey is WVVPKCPLXADLQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.C4H4N2/c1-4-5(2)3;1-2-6-4-3-5-1/h4H,1-2H2,3H3;1-4H.
What are the key properties of 2-methylbuta-1,3-diene;pyrazine?
2-methylbuta-1,3-diene;pyrazine has a molecular weight of 148.21 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-diene;pyrazine is sourced from PubChem (CID 175573056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).