About 1H-imidazole;2-methylbuta-1,3-diene
1H-imidazole;2-methylbuta-1,3-diene (PubChem CID 175599889) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1H-imidazole;2-methylbuta-1,3-diene.
Molecular Properties
| Compound Name | 1H-imidazole;2-methylbuta-1,3-diene |
| PubChem CID | 175599889 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1H-imidazole;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.c1c[nH]cn1 |
| InChI | InChI=1S/C5H8.C3H4N2/c1-4-5(2)3;1-2-5-3-4-1/h4H,1-2H2,3H3;1-3H,(H,4,5) |
| InChIKey | OJMQERUBYLACNR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;2-methylbuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;2-methylbuta-1,3-diene?
The IUPAC name of 1H-imidazole;2-methylbuta-1,3-diene (CID 175599889) is 1H-imidazole;2-methylbuta-1,3-diene.
What is the SMILES notation for 1H-imidazole;2-methylbuta-1,3-diene?
The canonical SMILES for 1H-imidazole;2-methylbuta-1,3-diene is C=CC(=C)C.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;2-methylbuta-1,3-diene?
The InChIKey is OJMQERUBYLACNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.C3H4N2/c1-4-5(2)3;1-2-5-3-4-1/h4H,1-2H2,3H3;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;2-methylbuta-1,3-diene?
1H-imidazole;2-methylbuta-1,3-diene has a molecular weight of 136.20 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;2-methylbuta-1,3-diene is sourced from PubChem (CID 175599889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).