C18H26 — CID 144613975
2-butyl-3-methyl-1-[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexa-1,3-diene (PubChem CID 144613975) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-butyl-3-methyl-1-[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexa-1,3-diene.
| Compound Name | 2-butyl-3-methyl-1-[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144613975 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-butyl-3-methyl-1-[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexa-1,3-diene |
| SMILES | C=C/C(C)=C(\C=C)C1=C(CCCC)C(C)=CCC1 |
| InChI | InChI=1S/C18H26/c1-6-9-12-17-15(5)11-10-13-18(17)16(8-3)14(4)7-2/h7-8,11H,2-3,6,9-10,12-13H2,1,4-5H3/b16-14+ |
| InChIKey | DJCPXLKWXMUAPT-JQIJEIRASA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|