About butyl cyclobutene-1-carboxylate;ethenyl acetate
butyl cyclobutene-1-carboxylate;ethenyl acetate (PubChem CID 87747316) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is butyl cyclobutene-1-carboxylate;ethenyl acetate.
Molecular Properties
| Compound Name | butyl cyclobutene-1-carboxylate;ethenyl acetate |
| PubChem CID | 87747316 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | butyl cyclobutene-1-carboxylate;ethenyl acetate |
| SMILES | C=COC(C)=O.CCCCOC(=O)C1=CCC1 |
| InChI | InChI=1S/C9H14O2.C4H6O2/c1-2-3-7-11-9(10)8-5-4-6-8;1-3-6-4(2)5/h5H,2-4,6-7H2,1H3;3H,1H2,2H3 |
| InChIKey | ZAMRYKRWXHSTOV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl cyclobutene-1-carboxylate;ethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl cyclobutene-1-carboxylate;ethenyl acetate?
The IUPAC name of butyl cyclobutene-1-carboxylate;ethenyl acetate (CID 87747316) is butyl cyclobutene-1-carboxylate;ethenyl acetate.
What is the SMILES notation for butyl cyclobutene-1-carboxylate;ethenyl acetate?
The canonical SMILES for butyl cyclobutene-1-carboxylate;ethenyl acetate is C=COC(C)=O.CCCCOC(=O)C1=CCC1.
What is the InChIKey of butyl cyclobutene-1-carboxylate;ethenyl acetate?
The InChIKey is ZAMRYKRWXHSTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C4H6O2/c1-2-3-7-11-9(10)8-5-4-6-8;1-3-6-4(2)5/h5H,2-4,6-7H2,1H3;3H,1H2,2H3.
What are the key properties of butyl cyclobutene-1-carboxylate;ethenyl acetate?
butyl cyclobutene-1-carboxylate;ethenyl acetate has a molecular weight of 240.30 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl cyclobutene-1-carboxylate;ethenyl acetate is sourced from PubChem (CID 87747316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).