About ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate
ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate (PubChem CID 121317149) has the molecular formula C19H32O4
and a molecular weight of 324.46 g/mol. Its IUPAC name is ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate.
Molecular Properties
| Compound Name | ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate |
| PubChem CID | 121317149 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate |
| SMILES | C=COC(C)=O.CCCCCCCC1=C(C(=O)OCCC)CC1 |
| InChI | InChI=1S/C15H26O2.C4H6O2/c1-3-5-6-7-8-9-13-10-11-14(13)15(16)17-12-4-2;1-3-6-4(2)5/h3-12H2,1-2H3;3H,1H2,2H3 |
| InChIKey | KYTYAEGKDBCKGX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate?
The IUPAC name of ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate (CID 121317149) is ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate.
What is the SMILES notation for ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate?
The canonical SMILES for ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate is C=COC(C)=O.CCCCCCCC1=C(C(=O)OCCC)CC1.
What is the InChIKey of ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate?
The InChIKey is KYTYAEGKDBCKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2.C4H6O2/c1-3-5-6-7-8-9-13-10-11-14(13)15(16)17-12-4-2;1-3-6-4(2)5/h3-12H2,1-2H3;3H,1H2,2H3.
What are the key properties of ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate?
ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate has a molecular weight of 324.46 g/mol, XLogP of 5.08, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl acetate;propyl 2-heptylcyclobutene-1-carboxylate is sourced from PubChem (CID 121317149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).