C24H44O4 — CID 174850858
ethenyl acetate;hexadecyl 2-methylprop-2-enoate (PubChem CID 174850858) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is ethenyl acetate;hexadecyl 2-methylprop-2-enoate.
| Compound Name | ethenyl acetate;hexadecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174850858 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | ethenyl acetate;hexadecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCCCCCC.C=COC(C)=O |
| InChI | InChI=1S/C20H38O2.C4H6O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-20(21)19(2)3;1-3-6-4(2)5/h2,4-18H2,1,3H3;3H,1H2,2H3 |
| InChIKey | ZJCMAPWBQKBPIP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|