C26H48O4 — CID 159374874
ethenyl acetate;octadecyl 2-methylprop-2-enoate (PubChem CID 159374874) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is ethenyl acetate;octadecyl 2-methylprop-2-enoate.
| Compound Name | ethenyl acetate;octadecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159374874 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | ethenyl acetate;octadecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCCCCCCCC.C=COC(C)=O |
| InChI | InChI=1S/C22H42O2.C4H6O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;1-3-6-4(2)5/h2,4-20H2,1,3H3;3H,1H2,2H3 |
| InChIKey | LKEMDXQOZNZRTC-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|