C18H24 — CID 144613405
1-methyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]-2-propylbenzene (PubChem CID 144613405) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-methyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]-2-propylbenzene.
| Compound Name | 1-methyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]-2-propylbenzene |
|---|---|
| PubChem CID | 144613405 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1-methyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]-2-propylbenzene |
| SMILES | C=C/C(C)=C(\C=C/C)c1cccc(C)c1CCC |
| InChI | InChI=1S/C18H24/c1-6-10-16(14(4)8-3)18-13-9-12-15(5)17(18)11-7-2/h6,8-10,12-13H,3,7,11H2,1-2,4-5H3/b10-6-,16-14+ |
| InChIKey | KBQKYDYTLVYHTG-XBOBXKGBSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|