C19H28 — CID 144660459
1-[(2Z,4E)-5,7-dimethylocta-2,4,7-trien-4-yl]-2-methylbenzene;ethane (PubChem CID 144660459) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-[(2Z,4E)-5,7-dimethylocta-2,4,7-trien-4-yl]-2-methylbenzene;ethane.
| Compound Name | 1-[(2Z,4E)-5,7-dimethylocta-2,4,7-trien-4-yl]-2-methylbenzene;ethane |
|---|---|
| PubChem CID | 144660459 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-[(2Z,4E)-5,7-dimethylocta-2,4,7-trien-4-yl]-2-methylbenzene;ethane |
| SMILES | C=C(C)C/C(C)=C(\C=C/C)c1ccccc1C.CC |
| InChI | InChI=1S/C17H22.C2H6/c1-6-9-16(15(5)12-13(2)3)17-11-8-7-10-14(17)4;1-2/h6-11H,2,12H2,1,3-5H3;1-2H3/b9-6-,16-15+; |
| InChIKey | BHLVNKFPNCVTOU-HCSDVFTNSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|