C21H27N — CID 167054725
4-methyl-1-[3-methyl-4-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]pent-4-en-1-imine (PubChem CID 167054725) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-methyl-1-[3-methyl-4-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]pent-4-en-1-imine.
| Compound Name | 4-methyl-1-[3-methyl-4-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]pent-4-en-1-imine |
|---|---|
| PubChem CID | 167054725 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 4-methyl-1-[3-methyl-4-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]pent-4-en-1-imine |
| SMILES | [H]/N=C(\CCC(=C)C)c1ccc(C(/C=C\C)=C(\C)C=C)c(C)c1 |
| InChI | InChI=1S/C21H27N/c1-7-9-19(16(5)8-2)20-12-11-18(14-17(20)6)21(22)13-10-15(3)4/h7-9,11-12,14,22H,2-3,10,13H2,1,4-6H3/b9-7-,19-16+,22-21+ |
| InChIKey | GADKAGHBCYVBJA-RHWBQSANSA-N |
| XLogP | 6.25 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|