C20H24N2 — CID 167054767
2-methyl-5-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]aniline (PubChem CID 167054767) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-methyl-5-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]aniline.
| Compound Name | 2-methyl-5-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]aniline |
|---|---|
| PubChem CID | 167054767 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-methyl-5-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]aniline |
| SMILES | [H]/N=C(\CCC(=C)C)c1ccc(-c2ccc(C)c(N)c2)c(C)c1 |
| InChI | InChI=1S/C20H24N2/c1-13(2)5-10-19(21)17-8-9-18(15(4)11-17)16-7-6-14(3)20(22)12-16/h6-9,11-12,21H,1,5,10,22H2,2-4H3/b21-19+ |
| InChIKey | ZJEYRPSTFJQPTR-XUTLUUPISA-N |
| XLogP | 5.28 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|