C19H21NO2 — CID 167054831
3-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]benzene-1,2-diol (PubChem CID 167054831) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]benzene-1,2-diol.
| Compound Name | 3-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 167054831 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3-[2-methyl-4-(4-methylpent-4-enimidoyl)phenyl]benzene-1,2-diol |
| SMILES | [H]/N=C(\CCC(=C)C)c1ccc(-c2cccc(O)c2O)c(C)c1 |
| InChI | InChI=1S/C19H21NO2/c1-12(2)7-10-17(20)14-8-9-15(13(3)11-14)16-5-4-6-18(21)19(16)22/h4-6,8-9,11,20-22H,1,7,10H2,2-3H3/b20-17+ |
| InChIKey | NZNQPJSYXRHSBY-LVZFUZTISA-N |
| XLogP | 4.80 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|