C14H17F3N2O — CID 145017288
1-[2-methyl-4-(4,4,4-trifluoro-3-methoxybutanimidoyl)phenyl]ethenamine (PubChem CID 145017288) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-[2-methyl-4-(4,4,4-trifluoro-3-methoxybutanimidoyl)phenyl]ethenamine.
| Compound Name | 1-[2-methyl-4-(4,4,4-trifluoro-3-methoxybutanimidoyl)phenyl]ethenamine |
|---|---|
| PubChem CID | 145017288 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-[2-methyl-4-(4,4,4-trifluoro-3-methoxybutanimidoyl)phenyl]ethenamine |
| SMILES | [H]/N=C(\CC(OC)C(F)(F)F)c1ccc(C(=C)N)c(C)c1 |
| InChI | InChI=1S/C14H17F3N2O/c1-8-6-10(4-5-11(8)9(2)18)12(19)7-13(20-3)14(15,16)17/h4-6,13,19H,2,7,18H2,1,3H3/b19-12+ |
| InChIKey | CHDNJANECWLJGV-XDHOZWIPSA-N |
| XLogP | 3.26 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|