C14H17ClS — CID 129096900
1-chloro-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylmethyl]-3-methylbenzene (PubChem CID 129096900) has the molecular formula C14H17ClS and a molecular weight of 252.81 g/mol. Its IUPAC name is 1-chloro-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylmethyl]-3-methylbenzene.
| Compound Name | 1-chloro-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylmethyl]-3-methylbenzene |
|---|---|
| PubChem CID | 129096900 |
| Molecular Formula | C14H17ClS |
| Molecular Weight | 252.81 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-chloro-2-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfanylmethyl]-3-methylbenzene |
| SMILES | C/C=C\C(=C/C)SCc1c(C)cccc1Cl |
| InChI | InChI=1S/C14H17ClS/c1-4-7-12(5-2)16-10-13-11(3)8-6-9-14(13)15/h4-9H,10H2,1-3H3/b7-4-,12-5+ |
| InChIKey | AQZIMVFSIKPOJM-FKBQNAHWSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|