C38H40O8 — CID 138972057
diethyl (2E,6E,10E)-4,9-bis[(E)-3-ethoxy-3-oxoprop-1-enyl]-5,8-diphenyldodeca-2,4,6,8,10-pentaenedioate (PubChem CID 138972057) has the molecular formula C38H40O8 and a molecular weight of 624.73 g/mol. Its IUPAC name is diethyl (2E,6E,10E)-4,9-bis[(E)-3-ethoxy-3-oxoprop-1-enyl]-5,8-diphenyldodeca-2,4,6,8,10-pentaenedioate.
| Compound Name | diethyl (2E,6E,10E)-4,9-bis[(E)-3-ethoxy-3-oxoprop-1-enyl]-5,8-diphenyldodeca-2,4,6,8,10-pentaenedioate |
|---|---|
| PubChem CID | 138972057 |
| Molecular Formula | C38H40O8 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | diethyl (2E,6E,10E)-4,9-bis[(E)-3-ethoxy-3-oxoprop-1-enyl]-5,8-diphenyldodeca-2,4,6,8,10-pentaenedioate |
| SMILES | CCOC(=O)/C=C/C(/C=C/C(=O)OCC)=C(/C=C/C(=C(/C=C/C(=O)OCC)/C=C/C(=O)OCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H40O8/c1-5-43-35(39)25-19-31(20-26-36(40)44-6-2)33(29-15-11-9-12-16-29)23-24-34(30-17-13-10-14-18-30)32(21-27-37(41)45-7-3)22-28-38(42)46-8-4/h9-28H,5-8H2,1-4H3/b24-23+,25-19+,26-20+,27-21+,28-22+ |
| InChIKey | NOYVDZFPFBKJJJ-FPUFIWGUSA-N |
| XLogP | 6.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|