C33H28O2 — CID 10718625
ethyl (2E,4E,6E)-4,5,6,7-tetraphenylhepta-2,4,6-trienoate (PubChem CID 10718625) has the molecular formula C33H28O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-4,5,6,7-tetraphenylhepta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-4,5,6,7-tetraphenylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 10718625 |
| Molecular Formula | C33H28O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | ethyl (2E,4E,6E)-4,5,6,7-tetraphenylhepta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C/C(=C(C(=C\c1ccccc1)\c1ccccc1)/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H28O2/c1-2-35-32(34)24-23-30(27-17-9-4-10-18-27)33(29-21-13-6-14-22-29)31(28-19-11-5-12-20-28)25-26-15-7-3-8-16-26/h3-25H,2H2,1H3/b24-23+,31-25+,33-30+ |
| InChIKey | IOMIQNUMJNAGPM-CWHMZCAKSA-N |
| XLogP | 7.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|