C18H22O2 — CID 102511638
ethyl (E)-4-cyclohexylidene-4-phenylbut-2-enoate (PubChem CID 102511638) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethyl (E)-4-cyclohexylidene-4-phenylbut-2-enoate.
| Compound Name | ethyl (E)-4-cyclohexylidene-4-phenylbut-2-enoate |
|---|---|
| PubChem CID | 102511638 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | ethyl (E)-4-cyclohexylidene-4-phenylbut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H22O2/c1-2-20-18(19)14-13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3,5-6,9-10,13-14H,2,4,7-8,11-12H2,1H3/b14-13+ |
| InChIKey | HJFUIPYNDOBRGM-BUHFOSPRSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|