C25H30O3Si — CID 102582147
ethyl (E,4E)-4-[2,2-dimethyl-5-(2-phenylethyl)oxasilolan-3-ylidene]-4-phenylbut-2-enoate (PubChem CID 102582147) has the molecular formula C25H30O3Si and a molecular weight of 406.60 g/mol. Its IUPAC name is ethyl (E,4E)-4-[2,2-dimethyl-5-(2-phenylethyl)oxasilolan-3-ylidene]-4-phenylbut-2-enoate.
| Compound Name | ethyl (E,4E)-4-[2,2-dimethyl-5-(2-phenylethyl)oxasilolan-3-ylidene]-4-phenylbut-2-enoate |
|---|---|
| PubChem CID | 102582147 |
| Molecular Formula | C25H30O3Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | ethyl (E,4E)-4-[2,2-dimethyl-5-(2-phenylethyl)oxasilolan-3-ylidene]-4-phenylbut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=C1/CC(CCc2ccccc2)O[Si]1(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H30O3Si/c1-4-27-25(26)18-17-23(21-13-9-6-10-14-21)24-19-22(28-29(24,2)3)16-15-20-11-7-5-8-12-20/h5-14,17-18,22H,4,15-16,19H2,1-3H3/b18-17+,24-23+ |
| InChIKey | QADHLGXJRZMKRT-QZOSNYCWSA-N |
| XLogP | 5.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|