About chlorobenzene;2-oxo-2-phenylethanethial
chlorobenzene;2-oxo-2-phenylethanethial (PubChem CID 160849489) has the molecular formula C14H11ClOS
and a molecular weight of 262.76 g/mol. Its IUPAC name is chlorobenzene;2-oxo-2-phenylethanethial.
Molecular Properties
| Compound Name | chlorobenzene;2-oxo-2-phenylethanethial |
| PubChem CID | 160849489 |
| Molecular Formula | C14H11ClOS |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | chlorobenzene;2-oxo-2-phenylethanethial |
| SMILES | Clc1ccccc1.O=C(C=S)c1ccccc1 |
| InChI | InChI=1S/C8H6OS.C6H5Cl/c9-8(6-10)7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-6H;1-5H |
| InChIKey | SJBNEKUWDZZCCP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;2-oxo-2-phenylethanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;2-oxo-2-phenylethanethial?
The IUPAC name of chlorobenzene;2-oxo-2-phenylethanethial (CID 160849489) is chlorobenzene;2-oxo-2-phenylethanethial.
What is the SMILES notation for chlorobenzene;2-oxo-2-phenylethanethial?
The canonical SMILES for chlorobenzene;2-oxo-2-phenylethanethial is Clc1ccccc1.O=C(C=S)c1ccccc1.
What is the InChIKey of chlorobenzene;2-oxo-2-phenylethanethial?
The InChIKey is SJBNEKUWDZZCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6OS.C6H5Cl/c9-8(6-10)7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-6H;1-5H.
What are the key properties of chlorobenzene;2-oxo-2-phenylethanethial?
chlorobenzene;2-oxo-2-phenylethanethial has a molecular weight of 262.76 g/mol, XLogP of 4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;2-oxo-2-phenylethanethial is sourced from PubChem (CID 160849489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).